Products 1537180-07-6

CAS 1537180-07-6 is the registry number for Roxadustat Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(chloromethyl)-4-phenoxybenzoyl chloride (CAS 1537180-07-6) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: 2-(chloromethyl)-4-phenoxybenzoyl chloride. InChIKey: CMAMRNKCNSWTFA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10Cl2O2
Molecular weight281.1 g/mol
IUPAC name2-(chloromethyl)-4-phenoxybenzoyl chloride
InChIKeyCMAMRNKCNSWTFA-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=CC(=C(C=C2)C(=O)Cl)CCl

Computed by PubChem (NCBI)