CAS 1537180-07-6 is the registry number for Roxadustat Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-4-phenoxybenzoyl chloride (CAS 1537180-07-6) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: 2-(chloromethyl)-4-phenoxybenzoyl chloride. InChIKey: CMAMRNKCNSWTFA-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2 |
|---|---|
| Molecular weight | 281.1 g/mol |
| IUPAC name | 2-(chloromethyl)-4-phenoxybenzoyl chloride |
| InChIKey | CMAMRNKCNSWTFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)C(=O)Cl)CCl |
Computed by PubChem (NCBI)