Products 1538375-45-9

CAS 1538375-45-9 is the registry number for 3-(2-Oxooxazolidin-4-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2-oxo-1,3-oxazolidin-4-yl)propanoic acid (CAS 1538375-45-9) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: 3-(2-oxo-1,3-oxazolidin-4-yl)propanoic acid. InChIKey: SPNJWSMCGHDXEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9NO4
Molecular weight159.14 g/mol
IUPAC name3-(2-oxo-1,3-oxazolidin-4-yl)propanoic acid
InChIKeySPNJWSMCGHDXEQ-UHFFFAOYSA-N
SMILESC1C(NC(=O)O1)CCC(=O)O

Computed by PubChem (NCBI)