Products 2763643-93-0

CAS 2763643-93-0 is the registry number for (R)-3-(2-Oxooxazolidin-4-yl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(4R)-2-oxo-1,3-oxazolidin-4-yl]propanoic acid (CAS 2763643-93-0) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: 3-[(4R)-2-oxo-1,3-oxazolidin-4-yl]propanoic acid. InChIKey: SPNJWSMCGHDXEQ-SCSAIBSYSA-N.

Identity
Molecular formulaC6H9NO4
Molecular weight159.14 g/mol
IUPAC name3-[(4R)-2-oxo-1,3-oxazolidin-4-yl]propanoic acid
InChIKeySPNJWSMCGHDXEQ-SCSAIBSYSA-N
SMILESC1[C@H](NC(=O)O1)CCC(=O)O

Computed by PubChem (NCBI)