CAS 2763643-93-0 is the registry number for (R)-3-(2-Oxooxazolidin-4-yl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4R)-2-oxo-1,3-oxazolidin-4-yl]propanoic acid (CAS 2763643-93-0) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: 3-[(4R)-2-oxo-1,3-oxazolidin-4-yl]propanoic acid. InChIKey: SPNJWSMCGHDXEQ-SCSAIBSYSA-N.
| Molecular formula | C6H9NO4 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | 3-[(4R)-2-oxo-1,3-oxazolidin-4-yl]propanoic acid |
| InChIKey | SPNJWSMCGHDXEQ-SCSAIBSYSA-N |
| SMILES | C1[C@H](NC(=O)O1)CCC(=O)O |
Computed by PubChem (NCBI)