CAS 1538624-34-8 appears in our catalog under these names: Amino Oxibendazole HCl, N-(Demethyl Formate) Oxibendazole Hydrochloride, >95% (HPLC), Oxibendazole-amine hydrochloride, Oxibendazole-amine hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 250mg, 1x1ml, 1x10mg.
6-propoxy-1H-benzimidazol-2-amine;hydrochloride (CAS 1538624-34-8) is a chemical compound with the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. IUPAC name: 6-propoxy-1H-benzimidazol-2-amine;hydrochloride. InChIKey: OQKLRUULRUKCQT-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 6-propoxy-1H-benzimidazol-2-amine;hydrochloride |
| InChIKey | OQKLRUULRUKCQT-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC2=C(C=C1)N=C(N2)N.Cl |
Computed by PubChem (NCBI)