CAS 153886-69-2 appears in our catalog under these names: Argatroban Impurity 9, Argatroban Impurity 1, 3-Methyl-8-quinolinesulfonic Acid, 3-Methylquinoline-8-sulfonic acid 95%, 3-Methyl-8-quinolinesulfonic acid, 95%, 95%. Offered by: Chemat Brand, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 2,5g, 100mg, 250mg, 1g.
3-methylquinoline-8-sulfonic acid (CAS 153886-69-2) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: 3-methylquinoline-8-sulfonic acid. InChIKey: BTBNYOKJERLLQI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 3-methylquinoline-8-sulfonic acid |
| InChIKey | BTBNYOKJERLLQI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=CC=C2)S(=O)(=O)O)N=C1 |
Computed by PubChem (NCBI)