Products 15398-66-0
CAS 15398-66-0 appears in our catalog under these names: Alpha–Guanosine, Alpha-Guanosine, 95.96%, Alpha-Guanosine, 95%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 50 mg, 25 mg, 5 mg, 10 mg, 1 mg.
2-amino-9-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 15398-66-0) is a chemical compound with the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. IUPAC name: 2-amino-9-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: NYHBQMYGNKIUIF-BDXYJKHTSA-N.
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 2-amino-9-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | NYHBQMYGNKIUIF-BDXYJKHTSA-N |
| SMILES | C1=NC2=C(N1[C@@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)