CAS 26578-09-6 appears in our catalog under these names: L–Guanosine, L-Guanosine 98%, L-Guanosine, 98%, 98%, L-Guanosine, 98.0%, L-Guanosine, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g, 5g, 25 mg, 100 mg, 10 mg.
2-amino-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 26578-09-6) is a chemical compound with the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. IUPAC name: 2-amino-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: NYHBQMYGNKIUIF-GIMIYPNGSA-N.
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 2-amino-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | NYHBQMYGNKIUIF-GIMIYPNGSA-N |
| SMILES | C1=NC2=C(N1[C@@H]3[C@H]([C@H]([C@@H](O3)CO)O)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)