Products 1539817-05-4
CAS 1539817-05-4 is the registry number for tert-butyl 3,3-dimethyl-5-nitro-indoline-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 3,3-dimethyl-5-nitro-2H-indole-1-carboxylate (CAS 1539817-05-4) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: tert-butyl 3,3-dimethyl-5-nitro-2H-indole-1-carboxylate. InChIKey: TXGYRCPTQJIBMD-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | tert-butyl 3,3-dimethyl-5-nitro-2H-indole-1-carboxylate |
| InChIKey | TXGYRCPTQJIBMD-UHFFFAOYSA-N |
| SMILES | CC1(CN(C2=C1C=C(C=C2)[N+](=O)[O-])C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)