Products 1539982-87-0
CAS 1539982-87-0 is the registry number for 3-(7-Chloro-2,3-dihydropyrido[2,3-b]pyrazin-4(1H)-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(7-chloro-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-yl)thiolane 1,1-dioxide (CAS 1539982-87-0) is a chemical compound with the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. IUPAC name: 3-(7-chloro-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-yl)thiolane 1,1-dioxide. InChIKey: PPFHUQNXVPXIOU-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2S |
|---|---|
| Molecular weight | 287.77 g/mol |
| IUPAC name | 3-(7-chloro-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-4-yl)thiolane 1,1-dioxide |
| InChIKey | PPFHUQNXVPXIOU-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2CCNC3=C2N=CC(=C3)Cl |
Computed by PubChem (NCBI)