CAS 1910076-23-1 is the registry number for (R)-2-Chloro-4-((tetrahydro-2H-pyran-4-yl)amino)-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-2-chloro-N-(oxan-4-yl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine (CAS 1910076-23-1) is a chemical compound with the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. IUPAC name: (5R)-2-chloro-N-(oxan-4-yl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine. InChIKey: INNYHOLWLAZUOA-GOSISDBHSA-N.
| Molecular formula | C11H14ClN3O2S |
|---|---|
| Molecular weight | 287.77 g/mol |
| IUPAC name | (5R)-2-chloro-N-(oxan-4-yl)-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
| InChIKey | INNYHOLWLAZUOA-GOSISDBHSA-N |
| SMILES | C1COCCC1NC2=NC(=NC3=C2[S@](=O)CC3)Cl |
Computed by PubChem (NCBI)