CAS 116970-50-4 appears in our catalog under these names: N-(2-Aminoethyl)-5-isoquinolinesulfonamide Hydrochloride, H-9 HCl 97%, 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-, hydrochloride (1:1), 97%, 97%, N-(2-Aminoethyl)isoquinoline-5-sulfonamide hydrochloride, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 25mg, 250mg, 1g, 5g, 25g.
N-(2-aminoethyl)isoquinoline-5-sulfonamide;hydrochloride (CAS 116970-50-4) is a chemical compound with the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. IUPAC name: N-(2-aminoethyl)isoquinoline-5-sulfonamide;hydrochloride. InChIKey: ZAMCOVXWUOADQX-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2S |
|---|---|
| Molecular weight | 287.77 g/mol |
| IUPAC name | N-(2-aminoethyl)isoquinoline-5-sulfonamide;hydrochloride |
| InChIKey | ZAMCOVXWUOADQX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)S(=O)(=O)NCCN.Cl |
Computed by PubChem (NCBI)