CAS 1826406-46-5 is the registry number for 2-Amino-N-(6-methoxybenzo[d]thiazol-2-yl)propanamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-N-(6-methoxy-1,3-benzothiazol-2-yl)propanamide;hydrochloride (CAS 1826406-46-5) is a chemical compound with the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. IUPAC name: 2-amino-N-(6-methoxy-1,3-benzothiazol-2-yl)propanamide;hydrochloride. InChIKey: YGJVOXXBYHKCAM-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2S |
|---|---|
| Molecular weight | 287.77 g/mol |
| IUPAC name | 2-amino-N-(6-methoxy-1,3-benzothiazol-2-yl)propanamide;hydrochloride |
| InChIKey | YGJVOXXBYHKCAM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=NC2=C(S1)C=C(C=C2)OC)N.Cl |
Computed by PubChem (NCBI)