CAS 1044761-22-9 is the registry number for 4-(Piperazine-1-sulfonyl)benzonitrile hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-piperazin-1-ylsulfonylbenzonitrile;hydrochloride (CAS 1044761-22-9) is a chemical compound with the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. IUPAC name: 4-piperazin-1-ylsulfonylbenzonitrile;hydrochloride. InChIKey: JTDZCMPQSAJERH-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2S |
|---|---|
| Molecular weight | 287.77 g/mol |
| IUPAC name | 4-piperazin-1-ylsulfonylbenzonitrile;hydrochloride |
| InChIKey | JTDZCMPQSAJERH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)