CAS 1540199-39-0 appears in our catalog under these names: 6'-Bromo-3'-chloro-2'-fluoroacetophenone, 98%, 1-(6-Bromo-3-chloro-2-fluorophenyl)ethan-1-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g.
1-(6-bromo-3-chloro-2-fluorophenyl)ethanone (CAS 1540199-39-0) is a chemical compound with the molecular formula C8H5BrClFO and a molecular weight of 251.48 g/mol. IUPAC name: 1-(6-bromo-3-chloro-2-fluorophenyl)ethanone. InChIKey: NAMYUIXIQALERX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO |
|---|---|
| Molecular weight | 251.48 g/mol |
| IUPAC name | 1-(6-bromo-3-chloro-2-fluorophenyl)ethanone |
| InChIKey | NAMYUIXIQALERX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1F)Cl)Br |
Computed by PubChem (NCBI)