CAS 1594605-40-9 is the registry number for 4'-Bromo-5'-chloro-2'-fluoroacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(4-bromo-5-chloro-2-fluorophenyl)ethanone (CAS 1594605-40-9) is a chemical compound with the molecular formula C8H5BrClFO and a molecular weight of 251.48 g/mol. IUPAC name: 1-(4-bromo-5-chloro-2-fluorophenyl)ethanone. InChIKey: UYZXJLRSUSUZHM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO |
|---|---|
| Molecular weight | 251.48 g/mol |
| IUPAC name | 1-(4-bromo-5-chloro-2-fluorophenyl)ethanone |
| InChIKey | UYZXJLRSUSUZHM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1F)Br)Cl |
Computed by PubChem (NCBI)