CAS 725743-40-8 is the registry number for 2-Bromo-1-(5-chloro-2-fluorophenyl)ethanone, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-bromo-1-(5-chloro-2-fluorophenyl)ethanone (CAS 725743-40-8) is a chemical compound with the molecular formula C8H5BrClFO and a molecular weight of 251.48 g/mol. IUPAC name: 2-bromo-1-(5-chloro-2-fluorophenyl)ethanone. InChIKey: KHHKWCFGQAYBFK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO |
|---|---|
| Molecular weight | 251.48 g/mol |
| IUPAC name | 2-bromo-1-(5-chloro-2-fluorophenyl)ethanone |
| InChIKey | KHHKWCFGQAYBFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)CBr)F |
Computed by PubChem (NCBI)