Products 2168475-95-2

CAS 2168475-95-2 is the registry number for 4-bromo-2-fluoro-3-methylbenzoyl chloride, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-bromo-2-fluoro-3-methylbenzoyl chloride (CAS 2168475-95-2) is a chemical compound with the molecular formula C8H5BrClFO and a molecular weight of 251.48 g/mol. IUPAC name: 4-bromo-2-fluoro-3-methylbenzoyl chloride. InChIKey: CMUXMKUTKOOLHC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrClFO
Molecular weight251.48 g/mol
IUPAC name4-bromo-2-fluoro-3-methylbenzoyl chloride
InChIKeyCMUXMKUTKOOLHC-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1F)C(=O)Cl)Br

Computed by PubChem (NCBI)