CAS 2168475-95-2 is the registry number for 4-bromo-2-fluoro-3-methylbenzoyl chloride, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-fluoro-3-methylbenzoyl chloride (CAS 2168475-95-2) is a chemical compound with the molecular formula C8H5BrClFO and a molecular weight of 251.48 g/mol. IUPAC name: 4-bromo-2-fluoro-3-methylbenzoyl chloride. InChIKey: CMUXMKUTKOOLHC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO |
|---|---|
| Molecular weight | 251.48 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-methylbenzoyl chloride |
| InChIKey | CMUXMKUTKOOLHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)C(=O)Cl)Br |
Computed by PubChem (NCBI)