Products 902775-91-1

CAS 902775-91-1 is the registry number for tert-Butyl N-(2-(4-aminobenzenesulfonamido)ethyl)carbamate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-[(4-aminophenyl)sulfonylamino]ethyl]carbamate (CAS 902775-91-1) is a chemical compound with the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. IUPAC name: tert-butyl N-[2-[(4-aminophenyl)sulfonylamino]ethyl]carbamate. InChIKey: RTNTUKJYLWHQSP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21N3O4S
Molecular weight315.39 g/mol
IUPAC nametert-butyl N-[2-[(4-aminophenyl)sulfonylamino]ethyl]carbamate
InChIKeyRTNTUKJYLWHQSP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCNS(=O)(=O)C1=CC=C(C=C1)N

Computed by PubChem (NCBI)