Products 3091872-47-5
CAS 3091872-47-5 is the registry number for tert-Butyl ((1-tosylhydrazineyl)methyl)carbamate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl N-[[amino-(4-methylphenyl)sulfonylamino]methyl]carbamate (CAS 3091872-47-5) is a chemical compound with the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. IUPAC name: tert-butyl N-[[amino-(4-methylphenyl)sulfonylamino]methyl]carbamate. InChIKey: ZKYIRRZEBLQLSD-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O4S |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | tert-butyl N-[[amino-(4-methylphenyl)sulfonylamino]methyl]carbamate |
| InChIKey | ZKYIRRZEBLQLSD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CNC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)