CAS 211512-14-0 is the registry number for N-(7-Aminoheptyl)-2-nitrobenzenesulfonamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N-(7-aminoheptyl)-2-nitrobenzenesulfonamide (CAS 211512-14-0) is a chemical compound with the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. IUPAC name: N-(7-aminoheptyl)-2-nitrobenzenesulfonamide. InChIKey: CSUADSIFEIGQDC-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O4S |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | N-(7-aminoheptyl)-2-nitrobenzenesulfonamide |
| InChIKey | CSUADSIFEIGQDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)NCCCCCCCN |
Computed by PubChem (NCBI)