CAS 887407-89-8 is the registry number for 3-(3,4-Dichlorophenyl)-1H-pyrazole-4-carbaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,4-dichlorophenyl)-1H-pyrazole-4-carbaldehyde (CAS 887407-89-8) is a chemical compound with the molecular formula C10H6Cl2N2O and a molecular weight of 241.07 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-1H-pyrazole-4-carbaldehyde. InChIKey: JWIFLTDLSUPDEX-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-1H-pyrazole-4-carbaldehyde |
| InChIKey | JWIFLTDLSUPDEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=NN2)C=O)Cl)Cl |
Computed by PubChem (NCBI)