CAS 1540753-39-6 appears in our catalog under these names: 4,7-Dimethyl-1h,2h,3h,4h-pyrido(2,3-b)pyrazin-2-one, 95%, 4,7-Dimethyl-1H,2H,3H,4H-pyrido(2,3-b)pyrazin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4,7-dimethyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one (CAS 1540753-39-6) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 4,7-dimethyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one. InChIKey: WMFJJQZKLKTSPY-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 4,7-dimethyl-1,3-dihydropyrido[2,3-b]pyrazin-2-one |
| InChIKey | WMFJJQZKLKTSPY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C1)N(CC(=O)N2)C |
Computed by PubChem (NCBI)