Products 1540847-46-8
CAS 1540847-46-8 is the registry number for 2-Hydroxy-5-({((3-methylthiophen-2-yl)methyl)carbamoyl}amino)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-hydroxy-5-[(3-methylthiophen-2-yl)methylcarbamoylamino]benzoic acid (CAS 1540847-46-8) is a chemical compound with the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. IUPAC name: 2-hydroxy-5-[(3-methylthiophen-2-yl)methylcarbamoylamino]benzoic acid. InChIKey: NSNBTGTVLXDLTB-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4S |
|---|---|
| Molecular weight | 306.34 g/mol |
| IUPAC name | 2-hydroxy-5-[(3-methylthiophen-2-yl)methylcarbamoylamino]benzoic acid |
| InChIKey | NSNBTGTVLXDLTB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)CNC(=O)NC2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)