Products 154092-64-5
CAS 154092-64-5 is the registry number for (S)-Benzyl 2-amino-3,3-dimethylbutanoate, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Benzyl (2S)-2-amino-3,3-dimethylbutanoate (CAS 154092-64-5) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: benzyl (2S)-2-amino-3,3-dimethylbutanoate. InChIKey: CFEYNMWFKQPQMR-LLVKDONJSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3,3-dimethylbutanoate |
| InChIKey | CFEYNMWFKQPQMR-LLVKDONJSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)
Synonyms:
(S)-Benzyl 2-amino-3,3-dimethylbutanoate, benzyl (2S)-2-amino-3,3-dimethylbutanoate, (S)-benzyl 2-amino-3,3-dimethylbutanoate(WXG02404), tert-leucine benzyl ester, Benzyl (2S)-2-amino-3,3-dimethyl-butanoate, Benzyl 3-methyl-L-valinate, CFEYNMWFKQPQMR-LLVKDONJSA-N, 3-Methyl-L-valine phenylmethyl ester, L-Valine, 3-methyl-, phenylmethyl ester, benzyl (S)-2-amino-3,3-dimethylbutanoate