Products 1541253-68-2
CAS 1541253-68-2 appears in our catalog under these names: Imidazo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione, 97%, 97%, Imidazo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
1H-imidazo[2,1-f][1,2,4]triazine-2,4-dione (CAS 1541253-68-2) is a chemical compound with the molecular formula C5H4N4O2 and a molecular weight of 152.11 g/mol. IUPAC name: 1H-imidazo[2,1-f][1,2,4]triazine-2,4-dione. InChIKey: OQCZUWSXPMWUJM-UHFFFAOYSA-N.
| Molecular formula | C5H4N4O2 |
|---|---|
| Molecular weight | 152.11 g/mol |
| IUPAC name | 1H-imidazo[2,1-f][1,2,4]triazine-2,4-dione |
| InChIKey | OQCZUWSXPMWUJM-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=N1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)