Products 1542158-69-9

CAS 1542158-69-9 is the registry number for 2-Benzyl 6-tert-butyl 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6-O-benzyl 2-O-tert-butyl 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate (CAS 1542158-69-9) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: 6-O-benzyl 2-O-tert-butyl 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate. InChIKey: QFOBRCWJAGYOII-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24N2O4
Molecular weight332.4 g/mol
IUPAC name6-O-benzyl 2-O-tert-butyl 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate
InChIKeyQFOBRCWJAGYOII-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2(C1)CN(C2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)