Products 370880-79-8

CAS 370880-79-8 is the registry number for 3-Benzyl 6-tert-butyl 3,6-diazabicyclo[3.2.0]heptane-3,6-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-O-benzyl 6-O-tert-butyl 3,6-diazabicyclo[3.2.0]heptane-3,6-dicarboxylate (CAS 370880-79-8) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: 3-O-benzyl 6-O-tert-butyl 3,6-diazabicyclo[3.2.0]heptane-3,6-dicarboxylate. InChIKey: GXIZSOVZVRKXEC-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24N2O4
Molecular weight332.4 g/mol
IUPAC name3-O-benzyl 6-O-tert-butyl 3,6-diazabicyclo[3.2.0]heptane-3,6-dicarboxylate
InChIKeyGXIZSOVZVRKXEC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2C1CN(C2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)