CAS 289677-06-1 appears in our catalog under these names: (S)-1-(1-((Benzyloxy)carbonyl)piperidin-4-yl)pyrrolidine-2-carboxylic acid, 97%, L-N-(4'-N-Cbz-piperidino)proline, 97%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
(2S)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)pyrrolidine-2-carboxylic acid (CAS 289677-06-1) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: (2S)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)pyrrolidine-2-carboxylic acid. InChIKey: QFKKBRVYWOSFQR-INIZCTEOSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (2S)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)pyrrolidine-2-carboxylic acid |
| InChIKey | QFKKBRVYWOSFQR-INIZCTEOSA-N |
| SMILES | C1C[C@H](N(C1)C2CCN(CC2)C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)