Products 1951445-03-6
CAS 1951445-03-6 is the registry number for tert-Butyl 4-(6-methyl-2-oxobenzo[d]oxazo l-3(2h)-yl) piperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl 4-(6-methyl-2-oxo-1,3-benzoxazol-3-yl)piperidine-1-carboxylate (CAS 1951445-03-6) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: tert-butyl 4-(6-methyl-2-oxo-1,3-benzoxazol-3-yl)piperidine-1-carboxylate. InChIKey: MJQKKDNZKSUHIW-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | tert-butyl 4-(6-methyl-2-oxo-1,3-benzoxazol-3-yl)piperidine-1-carboxylate |
| InChIKey | MJQKKDNZKSUHIW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=O)O2)C3CCN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)