Products 154317-89-2
CAS 154317-89-2 is the registry number for 2,2-Dimethyl-5-(4-nitrobenzyl)-1,3-dioxane-4,6-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-5-[(4-nitrophenyl)methyl]-1,3-dioxane-4,6-dione (CAS 154317-89-2) is a chemical compound with the molecular formula C13H13NO6 and a molecular weight of 279.24 g/mol. IUPAC name: 2,2-dimethyl-5-[(4-nitrophenyl)methyl]-1,3-dioxane-4,6-dione. InChIKey: FZKSUOXPWYRNEF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO6 |
|---|---|
| Molecular weight | 279.24 g/mol |
| IUPAC name | 2,2-dimethyl-5-[(4-nitrophenyl)methyl]-1,3-dioxane-4,6-dione |
| InChIKey | FZKSUOXPWYRNEF-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)CC2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)