Products 30761-97-8

CAS 30761-97-8 is the registry number for 2,5-Dioxopyrrolidin-1-yl (4-methoxybenzyl) carbonate, 99%. Offered by: Ambeed. Available pack sizes: 50mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) (4-methoxyphenyl)methyl carbonate (CAS 30761-97-8) is a chemical compound with the molecular formula C13H13NO6 and a molecular weight of 279.24 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (4-methoxyphenyl)methyl carbonate. InChIKey: RUPVJXBCXCVMAB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO6
Molecular weight279.24 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) (4-methoxyphenyl)methyl carbonate
InChIKeyRUPVJXBCXCVMAB-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)COC(=O)ON2C(=O)CCC2=O

Computed by PubChem (NCBI)