Products 888327-26-2

CAS 888327-26-2 is the registry number for Dimethyl 4-nitro-1h-indene-2,2(3h)-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Dimethyl 4-nitro-1,3-dihydroindene-2,2-dicarboxylate (CAS 888327-26-2) is a chemical compound with the molecular formula C13H13NO6 and a molecular weight of 279.24 g/mol. IUPAC name: dimethyl 4-nitro-1,3-dihydroindene-2,2-dicarboxylate. InChIKey: YNOARURNDVTFQP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO6
Molecular weight279.24 g/mol
IUPAC namedimethyl 4-nitro-1,3-dihydroindene-2,2-dicarboxylate
InChIKeyYNOARURNDVTFQP-UHFFFAOYSA-N
SMILESCOC(=O)C1(CC2=C(C1)C(=CC=C2)[N+](=O)[O-])C(=O)OC

Computed by PubChem (NCBI)