Products 1560874-18-1

CAS 1560874-18-1 is the registry number for Benzoic acid, 3-(methoxymethoxy)-, 2,5-dioxo-1-pyrrolidinyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 3-(methoxymethoxy)benzoate (CAS 1560874-18-1) is a chemical compound with the molecular formula C13H13NO6 and a molecular weight of 279.24 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-(methoxymethoxy)benzoate. InChIKey: YMIYZAUMTKIFME-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO6
Molecular weight279.24 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 3-(methoxymethoxy)benzoate
InChIKeyYMIYZAUMTKIFME-UHFFFAOYSA-N
SMILESCOCOC1=CC=CC(=C1)C(=O)ON2C(=O)CCC2=O

Computed by PubChem (NCBI)