Products 1543495-64-2

CAS 1543495-64-2 is the registry number for 4-(2-Cyanoethyl)thiomorpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(2-cyanoethyl)thiomorpholine-3-carboxylic acid (CAS 1543495-64-2) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 4-(2-cyanoethyl)thiomorpholine-3-carboxylic acid. InChIKey: QDEQTSKIRMNQPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O2S
Molecular weight200.26 g/mol
IUPAC name4-(2-cyanoethyl)thiomorpholine-3-carboxylic acid
InChIKeyQDEQTSKIRMNQPQ-UHFFFAOYSA-N
SMILESC1CSCC(N1CCC#N)C(=O)O

Computed by PubChem (NCBI)