Products 1544684-26-5
CAS 1544684-26-5 is the registry number for (2R,6S)-1-Ethyl-2,6-dimethylpiperazine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R,6S)-1-ethyl-2,6-dimethylpiperazine;dihydrochloride (CAS 1544684-26-5) is a chemical compound with the molecular formula C8H20Cl2N2 and a molecular weight of 215.16 g/mol. IUPAC name: (2R,6S)-1-ethyl-2,6-dimethylpiperazine;dihydrochloride. InChIKey: CCIWPJNDTVTIKI-QFHMQQKOSA-N.
| Molecular formula | C8H20Cl2N2 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | (2R,6S)-1-ethyl-2,6-dimethylpiperazine;dihydrochloride |
| InChIKey | CCIWPJNDTVTIKI-QFHMQQKOSA-N |
| SMILES | CCN1[C@@H](CNC[C@@H]1C)C.Cl.Cl |
Computed by PubChem (NCBI)