CAS 1545482-60-7 appears in our catalog under these names: 6-Bromo-3,5-dimethylimidazo(1,2-a)pyridine, 95%, 6-Bromo-3,5-dimethylimidazo(1,2-a)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-bromo-3,5-dimethylimidazo[1,2-a]pyridine (CAS 1545482-60-7) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-3,5-dimethylimidazo[1,2-a]pyridine. InChIKey: RRFZTCIUFBZFEE-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-3,5-dimethylimidazo[1,2-a]pyridine |
| InChIKey | RRFZTCIUFBZFEE-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2N1C(=C(C=C2)Br)C |
Computed by PubChem (NCBI)