CAS 1545621-38-2 is the registry number for 1–((tert–Butoxy)carbonyl)–4–fluoropyrrolidine–3–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g.
4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1545621-38-2) is a chemical compound with the molecular formula C10H16FNO4 and a molecular weight of 233.24 g/mol. IUPAC name: 4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: HEDHHUUQWWXVTC-UHFFFAOYSA-N.
| Molecular formula | C10H16FNO4 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | HEDHHUUQWWXVTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)F)C(=O)O |
Computed by PubChem (NCBI)