Products 1545756-38-4
CAS 1545756-38-4 appears in our catalog under these names: 5-Bromo-6-fluoro-1,3-benzoxazol-2-amine, 96%, 5-Bromo-6-fluoro-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
5-bromo-6-fluoro-1,3-benzoxazol-2-amine (CAS 1545756-38-4) is a chemical compound with the molecular formula C7H4BrFN2O and a molecular weight of 231.02 g/mol. IUPAC name: 5-bromo-6-fluoro-1,3-benzoxazol-2-amine. InChIKey: CLQSKKMZGJCSRE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2O |
|---|---|
| Molecular weight | 231.02 g/mol |
| IUPAC name | 5-bromo-6-fluoro-1,3-benzoxazol-2-amine |
| InChIKey | CLQSKKMZGJCSRE-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)F)OC(=N2)N |
Computed by PubChem (NCBI)