Products 1820640-57-0
CAS 1820640-57-0 appears in our catalog under these names: 4-bromo-6-fluoro-1,3-benzoxazol-2-amine, 96%, 4-Bromo-6-fluoro-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-bromo-6-fluoro-1,3-benzoxazol-2-amine (CAS 1820640-57-0) is a chemical compound with the molecular formula C7H4BrFN2O and a molecular weight of 231.02 g/mol. IUPAC name: 4-bromo-6-fluoro-1,3-benzoxazol-2-amine. InChIKey: DHNFZXANXARPQD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2O |
|---|---|
| Molecular weight | 231.02 g/mol |
| IUPAC name | 4-bromo-6-fluoro-1,3-benzoxazol-2-amine |
| InChIKey | DHNFZXANXARPQD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1OC(=N2)N)Br)F |
Computed by PubChem (NCBI)