Products 1820674-33-6
CAS 1820674-33-6 is the registry number for 6-bromo-7-fluoro-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromo-7-fluoro-1,3-benzoxazol-2-amine (CAS 1820674-33-6) is a chemical compound with the molecular formula C7H4BrFN2O and a molecular weight of 231.02 g/mol. IUPAC name: 6-bromo-7-fluoro-1,3-benzoxazol-2-amine. InChIKey: FUYVUNGDSJWSAL-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2O |
|---|---|
| Molecular weight | 231.02 g/mol |
| IUPAC name | 6-bromo-7-fluoro-1,3-benzoxazol-2-amine |
| InChIKey | FUYVUNGDSJWSAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=C(O2)N)F)Br |
Computed by PubChem (NCBI)