Products 2770966-34-0
CAS 2770966-34-0 is the registry number for 6-Bromo-3-fluoropyrazolo[1,5-a]pyridin-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-3-fluoropyrazolo[1,5-a]pyridin-4-ol (CAS 2770966-34-0) is a chemical compound with the molecular formula C7H4BrFN2O and a molecular weight of 231.02 g/mol. IUPAC name: 6-bromo-3-fluoropyrazolo[1,5-a]pyridin-4-ol. InChIKey: COFSJFHGHNUQBF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2O |
|---|---|
| Molecular weight | 231.02 g/mol |
| IUPAC name | 6-bromo-3-fluoropyrazolo[1,5-a]pyridin-4-ol |
| InChIKey | COFSJFHGHNUQBF-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C=NN2C=C1Br)F)O |
Computed by PubChem (NCBI)