CAS 2386740-46-9 is the registry number for 4-Bromo-7-fluorobenzo[d]isoxazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-7-fluoro-1,2-benzoxazol-3-amine (CAS 2386740-46-9) is a chemical compound with the molecular formula C7H4BrFN2O and a molecular weight of 231.02 g/mol. IUPAC name: 4-bromo-7-fluoro-1,2-benzoxazol-3-amine. InChIKey: CZFXNLOFJNREOB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2O |
|---|---|
| Molecular weight | 231.02 g/mol |
| IUPAC name | 4-bromo-7-fluoro-1,2-benzoxazol-3-amine |
| InChIKey | CZFXNLOFJNREOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)ON=C2N)Br |
Computed by PubChem (NCBI)