CAS 1545947-91-8 is the registry number for 3-Cyclopropyl-2-oxo-2,3-dihydro-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-cyclopropyl-2-oxo-1H-benzimidazole-5-carboxylic acid (CAS 1545947-91-8) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 3-cyclopropyl-2-oxo-1H-benzimidazole-5-carboxylic acid. InChIKey: JOALTBZZXLKPMS-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 3-cyclopropyl-2-oxo-1H-benzimidazole-5-carboxylic acid |
| InChIKey | JOALTBZZXLKPMS-UHFFFAOYSA-N |
| SMILES | C1CC1N2C3=C(C=CC(=C3)C(=O)O)NC2=O |
Computed by PubChem (NCBI)