CAS 15463-91-9 is the registry number for beta-Bromohydrocinnamic Acid. Offered by: TRC. Available pack sizes: 5g.
3-bromo-3-phenylpropanoic acid (CAS 15463-91-9) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 3-bromo-3-phenylpropanoic acid. InChIKey: JQRMHJWFYKSDNQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 3-bromo-3-phenylpropanoic acid |
| InChIKey | JQRMHJWFYKSDNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)Br |
Computed by PubChem (NCBI)