CAS 154669-49-5 appears in our catalog under these names: (4S)-4-[[[(4-Methylphenyl)sulfonyl]oxy]methyl]-2-oxazolidinone, 97%, 97%, (S)-(2-Oxooxazolidin-4-yl)methyl 4-methylbenzenesulfonate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
[(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl 4-methylbenzenesulfonate (CAS 154669-49-5) is a chemical compound with the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. IUPAC name: [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl 4-methylbenzenesulfonate. InChIKey: XZXRYNVWWTZADH-VIFPVBQESA-N.
| Molecular formula | C11H13NO5S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | [(4S)-2-oxo-1,3-oxazolidin-4-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | XZXRYNVWWTZADH-VIFPVBQESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2COC(=O)N2 |
Computed by PubChem (NCBI)