CAS 97899-36-0 appears in our catalog under these names: (2-Oxo-1,3-oxazolidin-4-yl)methyl 4-methylbenzene-1-sulfonate, 95%, (2-Oxo-1,3-oxazolidin-4-yl)methyl 4-methylbenzene-1-sulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(2-oxo-1,3-oxazolidin-4-yl)methyl 4-methylbenzenesulfonate (CAS 97899-36-0) is a chemical compound with the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. IUPAC name: (2-oxo-1,3-oxazolidin-4-yl)methyl 4-methylbenzenesulfonate. InChIKey: XZXRYNVWWTZADH-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | (2-oxo-1,3-oxazolidin-4-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | XZXRYNVWWTZADH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2COC(=O)N2 |
Computed by PubChem (NCBI)