CAS 154703-69-2 is the registry number for Ethyl 2-((4R,6S)-6-ethynyl-2,2-dimethyl-1,3-dioxan-4-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(4R,6S)-6-ethynyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 154703-69-2) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: ethyl 2-[(4R,6S)-6-ethynyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: SEQLRKLYEFAWIF-NXEZZACHSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | ethyl 2-[(4R,6S)-6-ethynyl-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | SEQLRKLYEFAWIF-NXEZZACHSA-N |
| SMILES | CCOC(=O)C[C@H]1C[C@H](OC(O1)(C)C)C#C |
Computed by PubChem (NCBI)