Products 1547093-97-9
CAS 1547093-97-9 is the registry number for 4-nitro-1H-indole-6-carboxylic acid. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-nitro-1H-indole-6-carboxylic acid (CAS 1547093-97-9) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 4-nitro-1H-indole-6-carboxylic acid. InChIKey: RDBWOFDEHBHBCU-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 4-nitro-1H-indole-6-carboxylic acid |
| InChIKey | RDBWOFDEHBHBCU-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=CC(=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)