Products 154741-40-9

CAS 154741-40-9 is the registry number for 1-tert-Butyl 3-(chloromethyl) piperidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-(chloromethyl) piperidine-1,3-dicarboxylate (CAS 154741-40-9) is a chemical compound with the molecular formula C12H20ClNO4 and a molecular weight of 277.74 g/mol. IUPAC name: 1-O-tert-butyl 3-O-(chloromethyl) piperidine-1,3-dicarboxylate. InChIKey: JJTKPJOFDRDGDA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20ClNO4
Molecular weight277.74 g/mol
IUPAC name1-O-tert-butyl 3-O-(chloromethyl) piperidine-1,3-dicarboxylate
InChIKeyJJTKPJOFDRDGDA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(C1)C(=O)OCCl

Computed by PubChem (NCBI)