Products 2137025-95-5

CAS 2137025-95-5 is the registry number for 1-tert-Butyl 2-chloromethyl (2r)-piperidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-(chloromethyl) (2R)-piperidine-1,2-dicarboxylate (CAS 2137025-95-5) is a chemical compound with the molecular formula C12H20ClNO4 and a molecular weight of 277.74 g/mol. IUPAC name: 1-O-tert-butyl 2-O-(chloromethyl) (2R)-piperidine-1,2-dicarboxylate. InChIKey: BTINZHKEPWFOBM-SECBINFHSA-N.

Identity
Molecular formulaC12H20ClNO4
Molecular weight277.74 g/mol
IUPAC name1-O-tert-butyl 2-O-(chloromethyl) (2R)-piperidine-1,2-dicarboxylate
InChIKeyBTINZHKEPWFOBM-SECBINFHSA-N
SMILESCC(C)(C)OC(=O)N1CCCC[C@@H]1C(=O)OCCl

Computed by PubChem (NCBI)